About 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol
2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol (PubChem CID 104961914) has the molecular formula C18H23NO2
and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol.
Molecular Properties
| Compound Name | 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol |
| PubChem CID | 104961914 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol |
| SMILES | CC(c1ccc2ccccc2c1O)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C18H23NO2/c1-12-10-19(11-13(2)21-12)14(3)16-9-8-15-6-4-5-7-17(15)18(16)20/h4-9,12-14,20H,10-11H2,1-3H3/t12-,13+,14? |
| InChIKey | RSTLRWMNLBBXKX-PBWFPOADSA-N |
| XLogP | 3.72 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol?
The IUPAC name of 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol (CID 104961914) is 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol.
What is the SMILES notation for 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol?
The canonical SMILES for 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol is CC(c1ccc2ccccc2c1O)N1C[C@@H](C)O[C@@H](C)C1.
What is the InChIKey of 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol?
The InChIKey is RSTLRWMNLBBXKX-PBWFPOADSA-N. The full InChI is InChI=1S/C18H23NO2/c1-12-10-19(11-13(2)21-12)14(3)16-9-8-15-6-4-5-7-17(15)18(16)20/h4-9,12-14,20H,10-11H2,1-3H3/t12-,13+,14?.
What are the key properties of 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol?
2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol has a molecular weight of 285.39 g/mol, XLogP of 3.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-ol is sourced from PubChem (CID 104961914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).