C11H14F3NO3 — CID 104962065
(1S,6R)-6-[methyl(2,2,2-trifluoroethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962065) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is (1S,6R)-6-[methyl(2,2,2-trifluoroethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[methyl(2,2,2-trifluoroethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962065 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (1S,6R)-6-[methyl(2,2,2-trifluoroethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CN(CC(F)(F)F)C(=O)[C@@H]1CC=CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H14F3NO3/c1-15(6-11(12,13)14)9(16)7-4-2-3-5-8(7)10(17)18/h2-3,7-8H,4-6H2,1H3,(H,17,18)/t7-,8+/m1/s1 |
| InChIKey | RRHLQVUGOUUIMR-SFYZADRCSA-N |
| XLogP | 1.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|