C14H21NO5 — CID 104962121
(1S,6R)-6-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962121) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is (1S,6R)-6-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962121 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (1S,6R)-6-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COC(=O)[C@@H](NC(=O)[C@@H]1CC=CC[C@@H]1C(=O)O)C(C)C |
| InChI | InChI=1S/C14H21NO5/c1-8(2)11(14(19)20-3)15-12(16)9-6-4-5-7-10(9)13(17)18/h4-5,8-11H,6-7H2,1-3H3,(H,15,16)(H,17,18)/t9-,10+,11+/m1/s1 |
| InChIKey | VDYDVRYJEXJNOP-VWYCJHECSA-N |
| XLogP | 0.97 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|