C15H25NO5 — CID 104962315
(1S,6R)-6-[2-methoxyethyl(1-methoxypropan-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962315) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is (1S,6R)-6-[2-methoxyethyl(1-methoxypropan-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[2-methoxyethyl(1-methoxypropan-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962315 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (1S,6R)-6-[2-methoxyethyl(1-methoxypropan-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COCCN(C(=O)[C@@H]1CC=CC[C@@H]1C(=O)O)C(C)COC |
| InChI | InChI=1S/C15H25NO5/c1-11(10-21-3)16(8-9-20-2)14(17)12-6-4-5-7-13(12)15(18)19/h4-5,11-13H,6-10H2,1-3H3,(H,18,19)/t11?,12-,13+/m1/s1 |
| InChIKey | UWZWDNVCCFPVMW-HDYSRYHKSA-N |
| XLogP | 1.16 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|