C15H16FNO3 — CID 104962361
(1S,6R)-6-[(3-fluorophenyl)-methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962361) has the molecular formula C15H16FNO3 and a molecular weight of 277.29 g/mol. Its IUPAC name is (1S,6R)-6-[(3-fluorophenyl)-methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[(3-fluorophenyl)-methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962361 |
| Molecular Formula | C15H16FNO3 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (1S,6R)-6-[(3-fluorophenyl)-methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CN(C(=O)[C@@H]1CC=CC[C@@H]1C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C15H16FNO3/c1-17(11-6-4-5-10(16)9-11)14(18)12-7-2-3-8-13(12)15(19)20/h2-6,9,12-13H,7-8H2,1H3,(H,19,20)/t12-,13+/m1/s1 |
| InChIKey | LXQQLDONUCRTLL-OLZOCXBDSA-N |
| XLogP | 2.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|