C14H19N3O3 — CID 104962746
(1S,6R)-6-[3-(1H-imidazol-2-yl)propylcarbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962746) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (1S,6R)-6-[3-(1H-imidazol-2-yl)propylcarbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[3-(1H-imidazol-2-yl)propylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962746 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (1S,6R)-6-[3-(1H-imidazol-2-yl)propylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)NCCCc1ncc[nH]1 |
| InChI | InChI=1S/C14H19N3O3/c18-13(10-4-1-2-5-11(10)14(19)20)17-7-3-6-12-15-8-9-16-12/h1-2,8-11H,3-7H2,(H,15,16)(H,17,18)(H,19,20)/t10-,11+/m1/s1 |
| InChIKey | SUFSEMNWGXCIMU-MNOVXSKESA-N |
| XLogP | 1.13 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|