C15H17N3O2 — CID 104962934
(1S,6R)-6-(1-ethylimidazo[4,5-c]pyridin-2-yl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962934) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (1S,6R)-6-(1-ethylimidazo[4,5-c]pyridin-2-yl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(1-ethylimidazo[4,5-c]pyridin-2-yl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962934 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (1S,6R)-6-(1-ethylimidazo[4,5-c]pyridin-2-yl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCn1c([C@@H]2CC=CC[C@@H]2C(=O)O)nc2cnccc21 |
| InChI | InChI=1S/C15H17N3O2/c1-2-18-13-7-8-16-9-12(13)17-14(18)10-5-3-4-6-11(10)15(19)20/h3-4,7-11H,2,5-6H2,1H3,(H,19,20)/t10-,11+/m1/s1 |
| InChIKey | ZTCSHDBLORMQNU-MNOVXSKESA-N |
| XLogP | 2.59 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|