C14H12BrN3O3 — CID 104963101
(1S,6R)-6-[3-(5-bromo-2-pyridinyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 104963101) has the molecular formula C14H12BrN3O3 and a molecular weight of 350.17 g/mol. Its IUPAC name is (1S,6R)-6-[3-(5-bromo-2-pyridinyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[3-(5-bromo-2-pyridinyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104963101 |
| Molecular Formula | C14H12BrN3O3 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | (1S,6R)-6-[3-(5-bromo-2-pyridinyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1c1nc(-c2ccc(Br)cn2)no1 |
| InChI | InChI=1S/C14H12BrN3O3/c15-8-5-6-11(16-7-8)12-17-13(21-18-12)9-3-1-2-4-10(9)14(19)20/h1-2,5-7,9-10H,3-4H2,(H,19,20)/t9-,10+/m1/s1 |
| InChIKey | RJVKGVOTJWAMNV-ZJUUUORDSA-N |
| XLogP | 3.03 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|