C16H23NO3 — CID 104963183
(3aS,7aR)-2-[[2-(hydroxymethyl)cyclohexyl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 104963183) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (3aS,7aR)-2-[[2-(hydroxymethyl)cyclohexyl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-[[2-(hydroxymethyl)cyclohexyl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 104963183 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (3aS,7aR)-2-[[2-(hydroxymethyl)cyclohexyl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CC=CC[C@H]2C(=O)N1CC1CCCCC1CO |
| InChI | InChI=1S/C16H23NO3/c18-10-12-6-2-1-5-11(12)9-17-15(19)13-7-3-4-8-14(13)16(17)20/h3-4,11-14,18H,1-2,5-10H2/t11?,12?,13-,14+ |
| InChIKey | CPJGJMVWWXYODQ-LLZFXZEUSA-N |
| XLogP | 1.74 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|