C19H34O4 — CID 10496388
(1E,2R,3aR,4S,7aS)-1-[5-(methoxymethoxy)-5-methylhexylidene]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-indene-2,4-diol (PubChem CID 10496388) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (1E,2R,3aR,4S,7aS)-1-[5-(methoxymethoxy)-5-methylhexylidene]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-indene-2,4-diol.
| Compound Name | (1E,2R,3aR,4S,7aS)-1-[5-(methoxymethoxy)-5-methylhexylidene]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-indene-2,4-diol |
|---|---|
| PubChem CID | 10496388 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (1E,2R,3aR,4S,7aS)-1-[5-(methoxymethoxy)-5-methylhexylidene]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-indene-2,4-diol |
| SMILES | COCOC(C)(C)CCC/C=C1/[C@H](O)C[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C19H34O4/c1-18(2,23-13-22-4)10-6-5-8-14-17(21)12-15-16(20)9-7-11-19(14,15)3/h8,15-17,20-21H,5-7,9-13H2,1-4H3/b14-8-/t15-,16-,17+,19+/m0/s1 |
| InChIKey | AWVDEQUBPYRUJZ-ZBCPDIJASA-N |
| XLogP | 3.41 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|