C18H19N5O — CID 10496436
(11R,15S)-5-benzyl-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one (PubChem CID 10496436) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is (11R,15S)-5-benzyl-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one.
| Compound Name | (11R,15S)-5-benzyl-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
|---|---|
| PubChem CID | 10496436 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (11R,15S)-5-benzyl-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
| SMILES | CN1C(=O)c2c(ncn2Cc2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C18H19N5O/c1-21-17(24)15-16(23-14-9-5-8-13(14)20-18(21)23)19-11-22(15)10-12-6-3-2-4-7-12/h2-4,6-7,11,13-14H,5,8-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | RAUOXIZVCWCSLS-KGLIPLIRSA-N |
| XLogP | 2.11 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |