C22H18N2O2S2 — CID 1049646
6-ethyl-2-phenacylsulfanyl-3-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 1049646) has the molecular formula C22H18N2O2S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 6-ethyl-2-phenacylsulfanyl-3-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-ethyl-2-phenacylsulfanyl-3-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 1049646 |
| Molecular Formula | C22H18N2O2S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 6-ethyl-2-phenacylsulfanyl-3-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1cc2c(=O)n(-c3ccccc3)c(SCC(=O)c3ccccc3)nc2s1 |
| InChI | InChI=1S/C22H18N2O2S2/c1-2-17-13-18-20(28-17)23-22(24(21(18)26)16-11-7-4-8-12-16)27-14-19(25)15-9-5-3-6-10-15/h3-13H,2,14H2,1H3 |
| InChIKey | JVLCGWQONFTWLW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |