C16H29NO4Si — CID 10496471
[(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] cyanate (PubChem CID 10496471) has the molecular formula C16H29NO4Si and a molecular weight of 327.50 g/mol. Its IUPAC name is [(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] cyanate.
| Compound Name | [(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] cyanate |
|---|---|
| PubChem CID | 10496471 |
| Molecular Formula | C16H29NO4Si |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | [(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] cyanate |
| SMILES | CC(C)O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)C=C[C@H]1OC#N |
| InChI | InChI=1S/C16H29NO4Si/c1-12(2)20-15-14(18-11-17)9-8-13(21-15)10-19-22(6,7)16(3,4)5/h8-9,12-15H,10H2,1-7H3/t13-,14+,15-/m0/s1 |
| InChIKey | GKQXFWSMKFEQHE-ZNMIVQPWSA-N |
| XLogP | 3.58 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|