C15H20O6S — CID 10496519
[(2S,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxiran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10496519) has the molecular formula C15H20O6S and a molecular weight of 328.39 g/mol. Its IUPAC name is [(2S,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxiran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxiran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10496519 |
| Molecular Formula | C15H20O6S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | [(2S,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxiran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2O[C@H]2[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C15H20O6S/c1-10-4-6-11(7-5-10)22(16,17)19-9-12-14(20-12)13-8-18-15(2,3)21-13/h4-7,12-14H,8-9H2,1-3H3/t12-,13+,14+/m0/s1 |
| InChIKey | BPQNIWPUHRSFTR-BFHYXJOUSA-N |
| XLogP | 1.62 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|