C16H24O5S — CID 10496529
[(2R,3R,5S,6R)-2-hydroxy-3,5,6-trimethyloxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10496529) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is [(2R,3R,5S,6R)-2-hydroxy-3,5,6-trimethyloxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,5S,6R)-2-hydroxy-3,5,6-trimethyloxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10496529 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(2R,3R,5S,6R)-2-hydroxy-3,5,6-trimethyloxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@]2(O)O[C@H](C)[C@@H](C)C[C@H]2C)cc1 |
| InChI | InChI=1S/C16H24O5S/c1-11-5-7-15(8-6-11)22(18,19)20-10-16(17)13(3)9-12(2)14(4)21-16/h5-8,12-14,17H,9-10H2,1-4H3/t12-,13+,14+,16-/m0/s1 |
| InChIKey | CZHHLUDJWWROTN-NHIYQJMISA-N |
| XLogP | 2.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|