C12H20N2O5 — CID 104966101
(2S,3R)-2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonylamino)-3-hydroxybutanoic acid (PubChem CID 104966101) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2S,3R)-2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonylamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104966101 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (2S,3R)-2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonylamino)-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)N1CCOC2CCCC21)C(=O)O |
| InChI | InChI=1S/C12H20N2O5/c1-7(15)10(11(16)17)13-12(18)14-5-6-19-9-4-2-3-8(9)14/h7-10,15H,2-6H2,1H3,(H,13,18)(H,16,17)/t7-,8?,9?,10+/m1/s1 |
| InChIKey | RRHYACJMEGDVTA-WOOKNIGNSA-N |
| XLogP | -0.22 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |