C10H21N3O4 — CID 104966438
(2S,3R)-3-hydroxy-2-[[methyl-[3-(methylamino)propyl]carbamoyl]amino]butanoic acid (PubChem CID 104966438) has the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[[methyl-[3-(methylamino)propyl]carbamoyl]amino]butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[[methyl-[3-(methylamino)propyl]carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 104966438 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[[methyl-[3-(methylamino)propyl]carbamoyl]amino]butanoic acid |
| SMILES | CNCCCN(C)C(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C10H21N3O4/c1-7(14)8(9(15)16)12-10(17)13(3)6-4-5-11-2/h7-8,11,14H,4-6H2,1-3H3,(H,12,17)(H,15,16)/t7-,8+/m1/s1 |
| InChIKey | VAEHFLAIOHVELS-SFYZADRCSA-N |
| XLogP | -0.93 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|