C22H34O2 — CID 10496680
3-[(3E,5E,8Z)-3,7,11-trimethyldodeca-3,5,8-trienyl]cyclohexene-1-carboxylic acid (PubChem CID 10496680) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is 3-[(3E,5E,8Z)-3,7,11-trimethyldodeca-3,5,8-trienyl]cyclohexene-1-carboxylic acid.
| Compound Name | 3-[(3E,5E,8Z)-3,7,11-trimethyldodeca-3,5,8-trienyl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 10496680 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 3-[(3E,5E,8Z)-3,7,11-trimethyldodeca-3,5,8-trienyl]cyclohexene-1-carboxylic acid |
| SMILES | C/C(=C\C=C\C(C)/C=C\CC(C)C)CCC1C=C(C(=O)O)CCC1 |
| InChI | InChI=1S/C22H34O2/c1-17(2)8-5-9-18(3)10-6-11-19(4)14-15-20-12-7-13-21(16-20)22(23)24/h5-6,9-11,16-18,20H,7-8,12-15H2,1-4H3,(H,23,24)/b9-5-,10-6+,19-11+ |
| InChIKey | POOTZJVXDGHNMQ-KFBGXEEASA-N |
| XLogP | 6.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|