C14H19ClN2O — CID 104966919
(3-amino-2-chlorophenyl)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]methanone (PubChem CID 104966919) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is (3-amino-2-chlorophenyl)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]methanone.
| Compound Name | (3-amino-2-chlorophenyl)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 104966919 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (3-amino-2-chlorophenyl)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(=O)c1cccc(N)c1Cl |
| InChI | InChI=1S/C14H19ClN2O/c1-9-5-3-6-10(2)17(9)14(18)11-7-4-8-12(16)13(11)15/h4,7-10H,3,5-6,16H2,1-2H3/t9-,10+ |
| InChIKey | CLFQXWNAHZSTLM-AOOOYVTPSA-N |
| XLogP | 3.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|