About 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline
2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline (PubChem CID 104966938) has the molecular formula C13H18BrFN2O2S
and a molecular weight of 365.27 g/mol. Its IUPAC name is 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline.
Molecular Properties
| Compound Name | 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline |
| PubChem CID | 104966938 |
| Molecular Formula | C13H18BrFN2O2S |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline |
| SMILES | C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c1cc(N)c(Br)cc1F |
| InChI | InChI=1S/C13H18BrFN2O2S/c1-8-4-3-5-9(2)17(8)20(18,19)13-7-12(16)10(14)6-11(13)15/h6-9H,3-5,16H2,1-2H3/t8-,9+ |
| InChIKey | ATJRSFHEWQBTSF-DTORHVGOSA-N |
| XLogP | 3.12 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline?
The IUPAC name of 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline (CID 104966938) is 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline.
What is the SMILES notation for 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline?
The canonical SMILES for 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline is C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c1cc(N)c(Br)cc1F.
What is the InChIKey of 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline?
The InChIKey is ATJRSFHEWQBTSF-DTORHVGOSA-N. The full InChI is InChI=1S/C13H18BrFN2O2S/c1-8-4-3-5-9(2)17(8)20(18,19)13-7-12(16)10(14)6-11(13)15/h6-9H,3-5,16H2,1-2H3/t8-,9+.
What are the key properties of 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline?
2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline has a molecular weight of 365.27 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-fluoroaniline is sourced from PubChem (CID 104966938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).