About 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid
4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid (PubChem CID 104967856) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid.
Molecular Properties
| Compound Name | 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid |
| PubChem CID | 104967856 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)CN1[C@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C12H21NO2/c1-9(7-12(14)15)8-13-10(2)5-4-6-11(13)3/h7,10-11H,4-6,8H2,1-3H3,(H,14,15)/t10-,11+ |
| InChIKey | UTGONAMBALVCDA-PHIMTYICSA-N |
| XLogP | 2.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid?
The IUPAC name of 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid (CID 104967856) is 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid.
What is the SMILES notation for 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid?
The canonical SMILES for 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid is CC(=CC(=O)O)CN1[C@H](C)CCC[C@@H]1C.
What is the InChIKey of 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid?
The InChIKey is UTGONAMBALVCDA-PHIMTYICSA-N. The full InChI is InChI=1S/C12H21NO2/c1-9(7-12(14)15)8-13-10(2)5-4-6-11(13)3/h7,10-11H,4-6,8H2,1-3H3,(H,14,15)/t10-,11+.
What are the key properties of 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid?
4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid has a molecular weight of 211.30 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-methylbut-2-enoic acid is sourced from PubChem (CID 104967856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).