C18H24N2O — CID 104968304
[3-(3-aminoprop-1-ynyl)-4-methylphenyl]-[(2S,6R)-2,6-dimethylpiperidin-1-yl]methanone (PubChem CID 104968304) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is [3-(3-aminoprop-1-ynyl)-4-methylphenyl]-[(2S,6R)-2,6-dimethylpiperidin-1-yl]methanone.
| Compound Name | [3-(3-aminoprop-1-ynyl)-4-methylphenyl]-[(2S,6R)-2,6-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 104968304 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | [3-(3-aminoprop-1-ynyl)-4-methylphenyl]-[(2S,6R)-2,6-dimethylpiperidin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2[C@H](C)CCC[C@@H]2C)cc1C#CCN |
| InChI | InChI=1S/C18H24N2O/c1-13-9-10-17(12-16(13)8-5-11-19)18(21)20-14(2)6-4-7-15(20)3/h9-10,12,14-15H,4,6-7,11,19H2,1-3H3/t14-,15+ |
| InChIKey | WVJHNLGAUSPKDJ-GASCZTMLSA-N |
| XLogP | 2.71 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|