About 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine
2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine (PubChem CID 10496846) has the molecular formula C17H21ClN4O
and a molecular weight of 332.84 g/mol. Its IUPAC name is 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine |
| PubChem CID | 10496846 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1c2ccc(OC)cc2c2c(Cl)ncnc21 |
| InChI | InChI=1S/C17H21ClN4O/c1-4-21(5-2)8-9-22-14-7-6-12(23-3)10-13(14)15-16(18)19-11-20-17(15)22/h6-7,10-11H,4-5,8-9H2,1-3H3 |
| InChIKey | BZWRNOLEJYEGCW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine?
The IUPAC name of 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine (CID 10496846) is 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine.
What is the SMILES notation for 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine?
The canonical SMILES for 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine is CCN(CC)CCn1c2ccc(OC)cc2c2c(Cl)ncnc21.
What is the InChIKey of 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine?
The InChIKey is BZWRNOLEJYEGCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN4O/c1-4-21(5-2)8-9-22-14-7-6-12(23-3)10-13(14)15-16(18)19-11-20-17(15)22/h6-7,10-11H,4-5,8-9H2,1-3H3.
What are the key properties of 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine?
2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine has a molecular weight of 332.84 g/mol, XLogP of 3.59, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-6-methoxypyrimido[4,5-b]indol-9-yl)-N,N-diethylethanamine is sourced from PubChem (CID 10496846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).