About 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline
4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline (PubChem CID 10496851) has the molecular formula C15H13BrN2S
and a molecular weight of 333.25 g/mol. Its IUPAC name is 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline |
| PubChem CID | 10496851 |
| Molecular Formula | C15H13BrN2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C15H13BrN2S/c1-18(2)12-6-3-10(4-7-12)15-17-13-8-5-11(16)9-14(13)19-15/h3-9H,1-2H3 |
| InChIKey | XTXFRDAVOASSRM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline?
The IUPAC name of 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline (CID 10496851) is 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline.
What is the SMILES notation for 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline?
The canonical SMILES for 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline is CN(C)c1ccc(-c2nc3ccc(Br)cc3s2)cc1.
What is the InChIKey of 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline?
The InChIKey is XTXFRDAVOASSRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrN2S/c1-18(2)12-6-3-10(4-7-12)15-17-13-8-5-11(16)9-14(13)19-15/h3-9H,1-2H3.
What are the key properties of 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline?
4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline has a molecular weight of 333.25 g/mol, XLogP of 4.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-bromo-1,3-benzothiazol-2-yl)-N,N-dimethylaniline is sourced from PubChem (CID 10496851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).