About [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone
[(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone (PubChem CID 104968886) has the molecular formula C15H25N5O
and a molecular weight of 291.40 g/mol. Its IUPAC name is [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone.
Molecular Properties
| Compound Name | [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone |
| PubChem CID | 104968886 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone |
| SMILES | CC(C)c1ncc(NN)c(C(=O)N2[C@H](C)CCC[C@@H]2C)n1 |
| InChI | InChI=1S/C15H25N5O/c1-9(2)14-17-8-12(19-16)13(18-14)15(21)20-10(3)6-5-7-11(20)4/h8-11,19H,5-7,16H2,1-4H3/t10-,11+ |
| InChIKey | QDHKRUHRGPKPQX-PHIMTYICSA-N |
| XLogP | 2.29 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone?
The IUPAC name of [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone (CID 104968886) is [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone.
What is the SMILES notation for [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone?
The canonical SMILES for [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone is CC(C)c1ncc(NN)c(C(=O)N2[C@H](C)CCC[C@@H]2C)n1.
What is the InChIKey of [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone?
The InChIKey is QDHKRUHRGPKPQX-PHIMTYICSA-N. The full InChI is InChI=1S/C15H25N5O/c1-9(2)14-17-8-12(19-16)13(18-14)15(21)20-10(3)6-5-7-11(20)4/h8-11,19H,5-7,16H2,1-4H3/t10-,11+.
What are the key properties of [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone?
[(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone has a molecular weight of 291.40 g/mol, XLogP of 2.29, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone is sourced from PubChem (CID 104968886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).