C16H21FINO3 — CID 104969700
tert-butyl 3-[(2-fluorophenyl)methoxy]-4-iodopyrrolidine-1-carboxylate (PubChem CID 104969700) has the molecular formula C16H21FINO3 and a molecular weight of 421.25 g/mol. Its IUPAC name is tert-butyl 3-[(2-fluorophenyl)methoxy]-4-iodopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-fluorophenyl)methoxy]-4-iodopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 104969700 |
| Molecular Formula | C16H21FINO3 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | tert-butyl 3-[(2-fluorophenyl)methoxy]-4-iodopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(I)C(OCc2ccccc2F)C1 |
| InChI | InChI=1S/C16H21FINO3/c1-16(2,3)22-15(20)19-8-13(18)14(9-19)21-10-11-6-4-5-7-12(11)17/h4-7,13-14H,8-10H2,1-3H3 |
| InChIKey | DZQIDUDOOLMOML-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|