C16H30INO5 — CID 104969779
tert-butyl 4-(iodomethyl)-4-[2-(2-methoxyethoxy)ethoxy]piperidine-1-carboxylate (PubChem CID 104969779) has the molecular formula C16H30INO5 and a molecular weight of 443.32 g/mol. Its IUPAC name is tert-butyl 4-(iodomethyl)-4-[2-(2-methoxyethoxy)ethoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(iodomethyl)-4-[2-(2-methoxyethoxy)ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 104969779 |
| Molecular Formula | C16H30INO5 |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | tert-butyl 4-(iodomethyl)-4-[2-(2-methoxyethoxy)ethoxy]piperidine-1-carboxylate |
| SMILES | COCCOCCOC1(CI)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30INO5/c1-15(2,3)23-14(19)18-7-5-16(13-17,6-8-18)22-12-11-21-10-9-20-4/h5-13H2,1-4H3 |
| InChIKey | GHMFCCKBSZPTGT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|