C19H21N5O — CID 10497022
(11R,15S)-3-benzyl-5,8-dimethyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one (PubChem CID 10497022) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is (11R,15S)-3-benzyl-5,8-dimethyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one.
| Compound Name | (11R,15S)-3-benzyl-5,8-dimethyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one |
|---|---|
| PubChem CID | 10497022 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (11R,15S)-3-benzyl-5,8-dimethyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one |
| SMILES | Cc1nn(Cc2ccccc2)c2c1C(=O)N(C)C1=N[C@@H]3CCC[C@@H]3N12 |
| InChI | InChI=1S/C19H21N5O/c1-12-16-17(23(21-12)11-13-7-4-3-5-8-13)24-15-10-6-9-14(15)20-19(24)22(2)18(16)25/h3-5,7-8,14-15H,6,9-11H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | YVOOLDONOWRIEB-CABCVRRESA-N |
| XLogP | 2.42 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |