C10H17N5O4S — CID 104970863
N-[2-(methanesulfonamido)ethyl]-5-pyrrolidin-2-yl-1,2,4-oxadiazole-3-carboxamide (PubChem CID 104970863) has the molecular formula C10H17N5O4S and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)ethyl]-5-pyrrolidin-2-yl-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-[2-(methanesulfonamido)ethyl]-5-pyrrolidin-2-yl-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 104970863 |
| Molecular Formula | C10H17N5O4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[2-(methanesulfonamido)ethyl]-5-pyrrolidin-2-yl-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1noc(C2CCCN2)n1 |
| InChI | InChI=1S/C10H17N5O4S/c1-20(17,18)13-6-5-12-9(16)8-14-10(19-15-8)7-3-2-4-11-7/h7,11,13H,2-6H2,1H3,(H,12,16) |
| InChIKey | ZGYUXKXYPBBNEE-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|