C14H22N4O — CID 104971654
3-ethyl-6-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]pyridazine-4-carboxamide (PubChem CID 104971654) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 3-ethyl-6-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]pyridazine-4-carboxamide.
| Compound Name | 3-ethyl-6-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104971654 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 3-ethyl-6-methyl-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]pyridazine-4-carboxamide |
| SMILES | CCc1nnc(C)cc1C(=O)NCC[C@H]1CCCN1 |
| InChI | InChI=1S/C14H22N4O/c1-3-13-12(9-10(2)17-18-13)14(19)16-8-6-11-5-4-7-15-11/h9,11,15H,3-8H2,1-2H3,(H,16,19)/t11-/m1/s1 |
| InChIKey | KHAAYDUVSHJIMC-LLVKDONJSA-N |
| XLogP | 1.22 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |