C12H17N3O2 — CID 104972057
2-oxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1H-pyridine-3-carboxamide (PubChem CID 104972057) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-oxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 104972057 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-oxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCC[C@H]1CCCN1)c1ccc[nH]c1=O |
| InChI | InChI=1S/C12H17N3O2/c16-11-10(4-2-7-14-11)12(17)15-8-5-9-3-1-6-13-9/h2,4,7,9,13H,1,3,5-6,8H2,(H,14,16)(H,15,17)/t9-/m1/s1 |
| InChIKey | XXZPWDKYQYLTJC-SECBINFHSA-N |
| XLogP | 0.25 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |