C14H18N2O3 — CID 104972064
N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 104972064) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 104972064 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCC[C@H]1CCCN1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18N2O3/c17-14(16-7-5-11-2-1-6-15-11)10-3-4-12-13(8-10)19-9-18-12/h3-4,8,11,15H,1-2,5-7,9H2,(H,16,17)/t11-/m1/s1 |
| InChIKey | OXWYVNRTSYTNPL-LLVKDONJSA-N |
| XLogP | 1.29 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |