C9H19N3O — CID 104972281
1-ethyl-3-[2-[(2R)-pyrrolidin-2-yl]ethyl]urea (PubChem CID 104972281) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-ethyl-3-[2-[(2R)-pyrrolidin-2-yl]ethyl]urea.
| Compound Name | 1-ethyl-3-[2-[(2R)-pyrrolidin-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 104972281 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 1-ethyl-3-[2-[(2R)-pyrrolidin-2-yl]ethyl]urea |
| SMILES | CCNC(=O)NCC[C@H]1CCCN1 |
| InChI | InChI=1S/C9H19N3O/c1-2-10-9(13)12-7-5-8-4-3-6-11-8/h8,11H,2-7H2,1H3,(H2,10,12,13)/t8-/m1/s1 |
| InChIKey | JNCNSIKZMYUJKM-MRVPVSSYSA-N |
| XLogP | 0.45 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |