C19H34N2O3 — CID 10497247
1-(3,5-dimethylmorpholin-4-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol (PubChem CID 10497247) has the molecular formula C19H34N2O3 and a molecular weight of 338.49 g/mol. Its IUPAC name is 1-(3,5-dimethylmorpholin-4-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol.
| Compound Name | 1-(3,5-dimethylmorpholin-4-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 10497247 |
| Molecular Formula | C19H34N2O3 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 1-(3,5-dimethylmorpholin-4-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
| SMILES | CC1COCC(C)N1CC(O)CO/N=C1\C[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C19H34N2O3/c1-13-10-23-11-14(2)21(13)9-16(22)12-24-20-17-8-15-6-7-19(17,5)18(15,3)4/h13-16,22H,6-12H2,1-5H3/b20-17+/t13?,14?,15-,16?,19+/m0/s1 |
| InChIKey | BMBCLFWHFTUOGN-FTFINZEUSA-N |
| XLogP | 2.68 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|