C13H19FN2O2S — CID 104972619
1-(4-fluorophenyl)-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]methanesulfonamide (PubChem CID 104972619) has the molecular formula C13H19FN2O2S and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 104972619 |
| Molecular Formula | C13H19FN2O2S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)NCC[C@@H]1CCCN1 |
| InChI | InChI=1S/C13H19FN2O2S/c14-12-5-3-11(4-6-12)10-19(17,18)16-9-7-13-2-1-8-15-13/h3-6,13,15-16H,1-2,7-10H2/t13-/m0/s1 |
| InChIKey | NSBXSWQOKLBMFK-ZDUSSCGKSA-N |
| XLogP | 1.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |