C20H25N3O2 — CID 10497309
1-[3,3-diethoxy-1-(3-methylphenyl)propyl]benzotriazole (PubChem CID 10497309) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[3,3-diethoxy-1-(3-methylphenyl)propyl]benzotriazole.
| Compound Name | 1-[3,3-diethoxy-1-(3-methylphenyl)propyl]benzotriazole |
|---|---|
| PubChem CID | 10497309 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-[3,3-diethoxy-1-(3-methylphenyl)propyl]benzotriazole |
| SMILES | CCOC(CC(c1cccc(C)c1)n1nnc2ccccc21)OCC |
| InChI | InChI=1S/C20H25N3O2/c1-4-24-20(25-5-2)14-19(16-10-8-9-15(3)13-16)23-18-12-7-6-11-17(18)21-22-23/h6-13,19-20H,4-5,14H2,1-3H3 |
| InChIKey | UYGMYLMGIGLSHH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|