C11H15F3N4 — CID 104973215
N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-6-(trifluoromethyl)pyridazin-3-amine (PubChem CID 104973215) has the molecular formula C11H15F3N4 and a molecular weight of 260.26 g/mol. Its IUPAC name is N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-6-(trifluoromethyl)pyridazin-3-amine.
| Compound Name | N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-6-(trifluoromethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 104973215 |
| Molecular Formula | C11H15F3N4 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-6-(trifluoromethyl)pyridazin-3-amine |
| SMILES | FC(F)(F)c1ccc(NCC[C@H]2CCCN2)nn1 |
| InChI | InChI=1S/C11H15F3N4/c12-11(13,14)9-3-4-10(18-17-9)16-7-5-8-2-1-6-15-8/h3-4,8,15H,1-2,5-7H2,(H,16,18)/t8-/m1/s1 |
| InChIKey | OZZZGAJEWRNORP-MRVPVSSYSA-N |
| XLogP | 2.05 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |