C14H21N3O3 — CID 104973218
3-ethoxy-2-nitro-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]aniline (PubChem CID 104973218) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-ethoxy-2-nitro-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]aniline.
| Compound Name | 3-ethoxy-2-nitro-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]aniline |
|---|---|
| PubChem CID | 104973218 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-ethoxy-2-nitro-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]aniline |
| SMILES | CCOc1cccc(NCC[C@H]2CCCN2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O3/c1-2-20-13-7-3-6-12(14(13)17(18)19)16-10-8-11-5-4-9-15-11/h3,6-7,11,15-16H,2,4-5,8-10H2,1H3/t11-/m1/s1 |
| InChIKey | VUSIUYIUSKVSDA-LLVKDONJSA-N |
| XLogP | 2.55 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|