About 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole
5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole (PubChem CID 104973764) has the molecular formula C10H16ClN3S
and a molecular weight of 245.78 g/mol. Its IUPAC name is 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole |
| PubChem CID | 104973764 |
| Molecular Formula | C10H16ClN3S |
| Molecular Weight | 245.78 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole |
| SMILES | CC1CN(Cc2ncc(Cl)s2)CC(C)N1 |
| InChI | InChI=1S/C10H16ClN3S/c1-7-4-14(5-8(2)13-7)6-10-12-3-9(11)15-10/h3,7-8,13H,4-6H2,1-2H3 |
| InChIKey | LAEUMRCWBZOANV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.78 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole?
The IUPAC name of 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole (CID 104973764) is 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole.
What is the SMILES notation for 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole?
The canonical SMILES for 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole is CC1CN(Cc2ncc(Cl)s2)CC(C)N1.
What is the InChIKey of 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole?
The InChIKey is LAEUMRCWBZOANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3S/c1-7-4-14(5-8(2)13-7)6-10-12-3-9(11)15-10/h3,7-8,13H,4-6H2,1-2H3.
What are the key properties of 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole?
5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole has a molecular weight of 245.78 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(3,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole is sourced from PubChem (CID 104973764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).