C12H16Br2N2OS — CID 104974496
N-(azepan-4-yl)-4,5-dibromo-N-methylthiophene-2-carboxamide (PubChem CID 104974496) has the molecular formula C12H16Br2N2OS and a molecular weight of 396.15 g/mol. Its IUPAC name is N-(azepan-4-yl)-4,5-dibromo-N-methylthiophene-2-carboxamide.
| Compound Name | N-(azepan-4-yl)-4,5-dibromo-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 104974496 |
| Molecular Formula | C12H16Br2N2OS |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | N-(azepan-4-yl)-4,5-dibromo-N-methylthiophene-2-carboxamide |
| SMILES | CN(C(=O)c1cc(Br)c(Br)s1)C1CCCNCC1 |
| InChI | InChI=1S/C12H16Br2N2OS/c1-16(8-3-2-5-15-6-4-8)12(17)10-7-9(13)11(14)18-10/h7-8,15H,2-6H2,1H3 |
| InChIKey | OFMUHOPURLWITP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |