C13H19N3O4S — CID 104975169
(3R)-1-(2,3-dimethyl-5-nitrophenyl)sulfonyl-3-methylpiperazine (PubChem CID 104975169) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is (3R)-1-(2,3-dimethyl-5-nitrophenyl)sulfonyl-3-methylpiperazine.
| Compound Name | (3R)-1-(2,3-dimethyl-5-nitrophenyl)sulfonyl-3-methylpiperazine |
|---|---|
| PubChem CID | 104975169 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (3R)-1-(2,3-dimethyl-5-nitrophenyl)sulfonyl-3-methylpiperazine |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N2CCN[C@H](C)C2)c1C |
| InChI | InChI=1S/C13H19N3O4S/c1-9-6-12(16(17)18)7-13(11(9)3)21(19,20)15-5-4-14-10(2)8-15/h6-7,10,14H,4-5,8H2,1-3H3/t10-/m1/s1 |
| InChIKey | IYHBKNQXUSAUFN-SNVBAGLBSA-N |
| XLogP | 1.19 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|