C10H18F3N3O2S — CID 104977801
(3aS,7aR)-N-(2,2,2-trifluoroethylsulfamoyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-amine (PubChem CID 104977801) has the molecular formula C10H18F3N3O2S and a molecular weight of 301.33 g/mol. Its IUPAC name is (3aS,7aR)-N-(2,2,2-trifluoroethylsulfamoyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-amine.
| Compound Name | (3aS,7aR)-N-(2,2,2-trifluoroethylsulfamoyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-amine |
|---|---|
| PubChem CID | 104977801 |
| Molecular Formula | C10H18F3N3O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (3aS,7aR)-N-(2,2,2-trifluoroethylsulfamoyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-amine |
| SMILES | O=S(=O)(NCC(F)(F)F)NC1CC[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C10H18F3N3O2S/c11-10(12,13)6-15-19(17,18)16-9-2-1-7-4-14-5-8(7)3-9/h7-9,14-16H,1-6H2/t7-,8+,9?/m0/s1 |
| InChIKey | KSJJCTCWYKFOKL-ZQTLJVIJSA-N |
| XLogP | 0.36 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |