About ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate
ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate (PubChem CID 1049779) has the molecular formula C12H14IN3O5
and a molecular weight of 407.16 g/mol. Its IUPAC name is ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate.
Molecular Properties
| Compound Name | ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate |
| PubChem CID | 1049779 |
| Molecular Formula | C12H14IN3O5 |
| Molecular Weight | 407.16 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate |
| SMILES | CCOC(=O)[C@H](N1CCCC1=O)n1cc(I)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H14IN3O5/c1-2-21-11(19)10(15-5-3-4-8(15)17)16-6-7(13)9(18)14-12(16)20/h6,10H,2-5H2,1H3,(H,14,18,20)/t10-/m1/s1 |
| InChIKey | RDWUEDLTTMOXHA-SNVBAGLBSA-N |
| XLogP | -0.17 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.16 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate?
The IUPAC name of ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate (CID 1049779) is ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate.
What is the SMILES notation for ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate?
The canonical SMILES for ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate is CCOC(=O)[C@H](N1CCCC1=O)n1cc(I)c(=O)[nH]c1=O.
What is the InChIKey of ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate?
The InChIKey is RDWUEDLTTMOXHA-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H14IN3O5/c1-2-21-11(19)10(15-5-3-4-8(15)17)16-6-7(13)9(18)14-12(16)20/h6,10H,2-5H2,1H3,(H,14,18,20)/t10-/m1/s1.
What are the key properties of ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate?
ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate has a molecular weight of 407.16 g/mol, XLogP of -0.17, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)-2-(2-oxopyrrolidin-1-yl)acetate is sourced from PubChem (CID 1049779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).