C10H20N2O6S — CID 104977995
(2S)-2-(ethylsulfamoylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 104977995) has the molecular formula C10H20N2O6S and a molecular weight of 296.35 g/mol. Its IUPAC name is (2S)-2-(ethylsulfamoylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | (2S)-2-(ethylsulfamoylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 104977995 |
| Molecular Formula | C10H20N2O6S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (2S)-2-(ethylsulfamoylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CCNS(=O)(=O)N[C@@H](CC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H20N2O6S/c1-5-11-19(16,17)12-7(9(14)15)6-8(13)18-10(2,3)4/h7,11-12H,5-6H2,1-4H3,(H,14,15)/t7-/m0/s1 |
| InChIKey | HPHXMKQHALJWOT-ZETCQYMHSA-N |
| XLogP | -0.38 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |