About 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide
4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide (PubChem CID 104978047) has the molecular formula C7H15N3O3S
and a molecular weight of 221.28 g/mol. Its IUPAC name is 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide |
| PubChem CID | 104978047 |
| Molecular Formula | C7H15N3O3S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide |
| SMILES | CNS(=O)(=O)N1CCC(=NO)C(C)C1 |
| InChI | InChI=1S/C7H15N3O3S/c1-6-5-10(14(12,13)8-2)4-3-7(6)9-11/h6,8,11H,3-5H2,1-2H3 |
| InChIKey | SHTJQGVPUGYXIO-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide?
The IUPAC name of 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide (CID 104978047) is 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide.
What is the SMILES notation for 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide?
The canonical SMILES for 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide is CNS(=O)(=O)N1CCC(=NO)C(C)C1.
What is the InChIKey of 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide?
The InChIKey is SHTJQGVPUGYXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O3S/c1-6-5-10(14(12,13)8-2)4-3-7(6)9-11/h6,8,11H,3-5H2,1-2H3.
What are the key properties of 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide?
4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide has a molecular weight of 221.28 g/mol, XLogP of -0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxyimino-N,3-dimethylpiperidine-1-sulfonamide is sourced from PubChem (CID 104978047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).