C9H16F3N3O3S — CID 104978049
3-ethyl-4-hydroxyimino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide (PubChem CID 104978049) has the molecular formula C9H16F3N3O3S and a molecular weight of 303.31 g/mol. Its IUPAC name is 3-ethyl-4-hydroxyimino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide.
| Compound Name | 3-ethyl-4-hydroxyimino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 104978049 |
| Molecular Formula | C9H16F3N3O3S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-ethyl-4-hydroxyimino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide |
| SMILES | CCC1CN(S(=O)(=O)NCC(F)(F)F)CCC1=NO |
| InChI | InChI=1S/C9H16F3N3O3S/c1-2-7-5-15(4-3-8(7)14-16)19(17,18)13-6-9(10,11)12/h7,13,16H,2-6H2,1H3 |
| InChIKey | DMWBPJRNVKAUJJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|