About (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol
(2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol (PubChem CID 104978063) has the molecular formula C5H11F3N2O3S
and a molecular weight of 236.22 g/mol. Its IUPAC name is (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol |
| PubChem CID | 104978063 |
| Molecular Formula | C5H11F3N2O3S |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol |
| SMILES | C[C@@H](CO)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C5H11F3N2O3S/c1-4(2-11)10-14(12,13)9-3-5(6,7)8/h4,9-11H,2-3H2,1H3/t4-/m0/s1 |
| InChIKey | YFVZLPVWLDXXQJ-BYPYZUCNSA-N |
| XLogP | -0.65 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol?
The IUPAC name of (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol (CID 104978063) is (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol.
What is the SMILES notation for (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol?
The canonical SMILES for (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol is C[C@@H](CO)NS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol?
The InChIKey is YFVZLPVWLDXXQJ-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H11F3N2O3S/c1-4(2-11)10-14(12,13)9-3-5(6,7)8/h4,9-11H,2-3H2,1H3/t4-/m0/s1.
What are the key properties of (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol?
(2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol has a molecular weight of 236.22 g/mol, XLogP of -0.65, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,2,2-trifluoroethylsulfamoylamino)propan-1-ol is sourced from PubChem (CID 104978063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).