About (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide
(3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide (PubChem CID 104978078) has the molecular formula C6H11F3N2O3S
and a molecular weight of 248.23 g/mol. Its IUPAC name is (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide.
Molecular Properties
| Compound Name | (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide |
| PubChem CID | 104978078 |
| Molecular Formula | C6H11F3N2O3S |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)F)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C6H11F3N2O3S/c7-6(8,9)4-10-15(13,14)11-2-1-5(12)3-11/h5,10,12H,1-4H2/t5-/m0/s1 |
| InChIKey | PGVDRVOCZZOFTM-YFKPBYRVSA-N |
| XLogP | -0.55 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide?
The IUPAC name of (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide (CID 104978078) is (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide.
What is the SMILES notation for (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide?
The canonical SMILES for (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide is O=S(=O)(NCC(F)(F)F)N1CC[C@H](O)C1.
What is the InChIKey of (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide?
The InChIKey is PGVDRVOCZZOFTM-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H11F3N2O3S/c7-6(8,9)4-10-15(13,14)11-2-1-5(12)3-11/h5,10,12H,1-4H2/t5-/m0/s1.
What are the key properties of (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide?
(3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide has a molecular weight of 248.23 g/mol, XLogP of -0.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-hydroxy-N-(2,2,2-trifluoroethyl)pyrrolidine-1-sulfonamide is sourced from PubChem (CID 104978078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).