C6H13F3N2O3S — CID 104978102
(2R)-2-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol (PubChem CID 104978102) has the molecular formula C6H13F3N2O3S and a molecular weight of 250.24 g/mol. Its IUPAC name is (2R)-2-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol.
| Compound Name | (2R)-2-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol |
|---|---|
| PubChem CID | 104978102 |
| Molecular Formula | C6H13F3N2O3S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (2R)-2-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol |
| SMILES | CC[C@H](CO)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H13F3N2O3S/c1-2-5(3-12)11-15(13,14)10-4-6(7,8)9/h5,10-12H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | LJTOULCXDZXBOK-RXMQYKEDSA-N |
| XLogP | -0.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |