C10H18F3N3O2S — CID 104978125
(3aR,7aS)-5-amino-N-(2,2,2-trifluoroethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-sulfonamide (PubChem CID 104978125) has the molecular formula C10H18F3N3O2S and a molecular weight of 301.33 g/mol. Its IUPAC name is (3aR,7aS)-5-amino-N-(2,2,2-trifluoroethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-sulfonamide.
| Compound Name | (3aR,7aS)-5-amino-N-(2,2,2-trifluoroethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-sulfonamide |
|---|---|
| PubChem CID | 104978125 |
| Molecular Formula | C10H18F3N3O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (3aR,7aS)-5-amino-N-(2,2,2-trifluoroethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-sulfonamide |
| SMILES | NC1CC[C@@H]2CN(S(=O)(=O)NCC(F)(F)F)C[C@@H]2C1 |
| InChI | InChI=1S/C10H18F3N3O2S/c11-10(12,13)6-15-19(17,18)16-4-7-1-2-9(14)3-8(7)5-16/h7-9,15H,1-6,14H2/t7-,8+,9?/m1/s1 |
| InChIKey | LJUAOMOJIHXLAR-WGTSGOJVSA-N |
| XLogP | 0.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |